C18H21N5O2S — CID 142801900
9-[5-[(4-methoxyphenyl)methylsulfanylmethyl]oxolan-2-yl]purin-6-amine (PubChem CID 142801900) has the molecular formula C18H21N5O2S and a molecular weight of 371.47 g/mol. Its IUPAC name is 9-[5-[(4-methoxyphenyl)methylsulfanylmethyl]oxolan-2-yl]purin-6-amine.
| Compound Name | 9-[5-[(4-methoxyphenyl)methylsulfanylmethyl]oxolan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 142801900 |
| Molecular Formula | C18H21N5O2S |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 9-[5-[(4-methoxyphenyl)methylsulfanylmethyl]oxolan-2-yl]purin-6-amine |
| SMILES | COc1ccc(CSCC2CCC(n3cnc4c(N)ncnc43)O2)cc1 |
| InChI | InChI=1S/C18H21N5O2S/c1-24-13-4-2-12(3-5-13)8-26-9-14-6-7-15(25-14)23-11-22-16-17(19)20-10-21-18(16)23/h2-5,10-11,14-15H,6-9H2,1H3,(H2,19,20,21) |
| InChIKey | YHDGZWHASYXWCW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |