C11H17N6O3PS — CID 163488341
9-[(2R,5S)-5-[2-[amino(hydroxy)phosphinothioyl]oxyethyl]oxolan-2-yl]purin-6-amine (PubChem CID 163488341) has the molecular formula C11H17N6O3PS and a molecular weight of 344.34 g/mol. Its IUPAC name is 9-[(2R,5S)-5-[2-[amino(hydroxy)phosphinothioyl]oxyethyl]oxolan-2-yl]purin-6-amine.
| Compound Name | 9-[(2R,5S)-5-[2-[amino(hydroxy)phosphinothioyl]oxyethyl]oxolan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 163488341 |
| Molecular Formula | C11H17N6O3PS |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 9-[(2R,5S)-5-[2-[amino(hydroxy)phosphinothioyl]oxyethyl]oxolan-2-yl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2[C@H]1CC[C@@H](CCOP(N)(O)=S)O1 |
| InChI | InChI=1S/C11H17N6O3PS/c12-10-9-11(15-5-14-10)17(6-16-9)8-2-1-7(20-8)3-4-19-21(13,18)22/h5-8H,1-4H2,(H2,12,14,15)(H3,13,18,22)/t7-,8+,21?/m0/s1 |
| InChIKey | CKLULBBYRNWXPD-YESMXMFPSA-N |
| XLogP | 0.67 |
| TPSA | 134.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|