C10H15N5NaO11P3 — CID 23689368
sodium [(2S,5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]methyl [hydroxy(phosphonooxy)phosphoryl] phosphate (PubChem CID 23689368) has the molecular formula C10H15N5NaO11P3 and a molecular weight of 497.17 g/mol. Its IUPAC name is sodium [(2S,5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]methyl [hydroxy(phosphonooxy)phosphoryl] phosphate.
| Compound Name | sodium [(2S,5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]methyl [hydroxy(phosphonooxy)phosphoryl] phosphate |
|---|---|
| PubChem CID | 23689368 |
| Molecular Formula | C10H15N5NaO11P3 |
| Molecular Weight | 497.17 g/mol |
| Exact Mass | 496.99 |
| IUPAC Name | sodium [(2S,5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]methyl [hydroxy(phosphonooxy)phosphoryl] phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@H]1CC[C@@H](COP(=O)([O-])OP(=O)(O)OP(=O)(O)O)O1.[Na+] |
| InChI | InChI=1S/C10H16N5O11P3.Na/c11-9-8-10(13-4-12-9)15(5-14-8)7-2-1-6(24-7)3-23-28(19,20)26-29(21,22)25-27(16,17)18;/h4-7H,1-3H2,(H,19,20)(H,21,22)(H2,11,12,13)(H2,16,17,18);/q;+1/p-1/t6-,7+;/m0./s1 |
| InChIKey | LSONWOOBEILFDO-UOERWJHTSA-M |
| XLogP | -3.20 |
| TPSA | 241.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.17 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|