C13H19N5O3 — CID 165130368
acetylene;[5-(6-aminopurin-9-yl)oxolan-2-yl]methanol;methanol (PubChem CID 165130368) has the molecular formula C13H19N5O3 and a molecular weight of 293.33 g/mol. Its IUPAC name is acetylene;[5-(6-aminopurin-9-yl)oxolan-2-yl]methanol;methanol.
| Compound Name | acetylene;[5-(6-aminopurin-9-yl)oxolan-2-yl]methanol;methanol |
|---|---|
| PubChem CID | 165130368 |
| Molecular Formula | C13H19N5O3 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | acetylene;[5-(6-aminopurin-9-yl)oxolan-2-yl]methanol;methanol |
| SMILES | C#C.CO.Nc1ncnc2c1ncn2C1CCC(CO)O1 |
| InChI | InChI=1S/C10H13N5O2.C2H2.CH4O/c11-9-8-10(13-4-12-9)15(5-14-8)7-2-1-6(3-16)17-7;2*1-2/h4-7,16H,1-3H2,(H2,11,12,13);1-2H;2H,1H3 |
| InChIKey | BGJMABXSHFRCQA-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|