C10H11FN4O2 — CID 67868000
[(2S,5S)-5-(6-fluoropurin-9-yl)oxolan-2-yl]methanol (PubChem CID 67868000) has the molecular formula C10H11FN4O2 and a molecular weight of 238.22 g/mol. Its IUPAC name is [(2S,5S)-5-(6-fluoropurin-9-yl)oxolan-2-yl]methanol.
| Compound Name | [(2S,5S)-5-(6-fluoropurin-9-yl)oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 67868000 |
| Molecular Formula | C10H11FN4O2 |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | [(2S,5S)-5-(6-fluoropurin-9-yl)oxolan-2-yl]methanol |
| SMILES | OC[C@@H]1CC[C@@H](n2cnc3c(F)ncnc32)O1 |
| InChI | InChI=1S/C10H11FN4O2/c11-9-8-10(13-4-12-9)15(5-14-8)7-2-1-6(3-16)17-7/h4-7,16H,1-3H2/t6-,7-/m0/s1 |
| InChIKey | SZWXQUMUPFALSF-BQBZGAKWSA-N |
| XLogP | 0.64 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |