C12H14FN5O2 — CID 145281051
acetylene;[5-(6-amino-2-fluoropurin-9-yl)oxolan-2-yl]methanol (PubChem CID 145281051) has the molecular formula C12H14FN5O2 and a molecular weight of 279.27 g/mol. Its IUPAC name is acetylene;[5-(6-amino-2-fluoropurin-9-yl)oxolan-2-yl]methanol.
| Compound Name | acetylene;[5-(6-amino-2-fluoropurin-9-yl)oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 145281051 |
| Molecular Formula | C12H14FN5O2 |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | acetylene;[5-(6-amino-2-fluoropurin-9-yl)oxolan-2-yl]methanol |
| SMILES | C#C.Nc1nc(F)nc2c1ncn2C1CCC(CO)O1 |
| InChI | InChI=1S/C10H12FN5O2.C2H2/c11-10-14-8(12)7-9(15-10)16(4-13-7)6-2-1-5(3-17)18-6;1-2/h4-6,17H,1-3H2,(H2,12,14,15);1-2H |
| InChIKey | BXYBMJCBIXLQMK-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|