C14H19N5O2 — CID 169190113
acetylene;[(2S)-5-(6-amino-2-ethylpurin-9-yl)oxolan-2-yl]methanol (PubChem CID 169190113) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is acetylene;[(2S)-5-(6-amino-2-ethylpurin-9-yl)oxolan-2-yl]methanol.
| Compound Name | acetylene;[(2S)-5-(6-amino-2-ethylpurin-9-yl)oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 169190113 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | acetylene;[(2S)-5-(6-amino-2-ethylpurin-9-yl)oxolan-2-yl]methanol |
| SMILES | C#C.CCc1nc(N)c2ncn(C3CC[C@@H](CO)O3)c2n1 |
| InChI | InChI=1S/C12H17N5O2.C2H2/c1-2-8-15-11(13)10-12(16-8)17(6-14-10)9-4-3-7(5-18)19-9;1-2/h6-7,9,18H,2-5H2,1H3,(H2,13,15,16);1-2H/t7-,9?;/m0./s1 |
| InChIKey | OLHUTRPZDRBASC-MCNHTDSKSA-N |
| XLogP | 0.89 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|