C10H14N6O3 — CID 130402904
1,2-diamino-9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]purin-6-one (PubChem CID 130402904) has the molecular formula C10H14N6O3 and a molecular weight of 266.26 g/mol. Its IUPAC name is 1,2-diamino-9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]purin-6-one.
| Compound Name | 1,2-diamino-9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]purin-6-one |
|---|---|
| PubChem CID | 130402904 |
| Molecular Formula | C10H14N6O3 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 1,2-diamino-9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]purin-6-one |
| SMILES | Nc1nc2c(ncn2[C@H]2CC[C@@H](CO)O2)c(=O)n1N |
| InChI | InChI=1S/C10H14N6O3/c11-10-14-8-7(9(18)16(10)12)13-4-15(8)6-2-1-5(3-17)19-6/h4-6,17H,1-3,12H2,(H2,11,14)/t5-,6+/m0/s1 |
| InChIKey | UDBDVPWPWILBRL-NTSWFWBYSA-N |
| XLogP | -1.44 |
| TPSA | 134.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |