C12H15N5O3 — CID 155804012
2-(ethylideneamino)-9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 155804012) has the molecular formula C12H15N5O3 and a molecular weight of 277.28 g/mol. Its IUPAC name is 2-(ethylideneamino)-9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-(ethylideneamino)-9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 155804012 |
| Molecular Formula | C12H15N5O3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 2-(ethylideneamino)-9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | CC=Nc1nc2c(ncn2[C@H]2CC[C@@H](CO)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C12H15N5O3/c1-2-13-12-15-10-9(11(19)16-12)14-6-17(10)8-4-3-7(5-18)20-8/h2,6-8,18H,3-5H2,1H3,(H,15,16,19)/t7-,8+/m0/s1 |
| InChIKey | KLZCFRHKIXQBFJ-JGVFFNPUSA-N |
| XLogP | 0.51 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|