C16H24N6O2 — CID 56967848
[(2S,5R)-5-[2-amino-6-(cyclohexylamino)purin-9-yl]oxolan-2-yl]methanol (PubChem CID 56967848) has the molecular formula C16H24N6O2 and a molecular weight of 332.41 g/mol. Its IUPAC name is [(2S,5R)-5-[2-amino-6-(cyclohexylamino)purin-9-yl]oxolan-2-yl]methanol.
| Compound Name | [(2S,5R)-5-[2-amino-6-(cyclohexylamino)purin-9-yl]oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 56967848 |
| Molecular Formula | C16H24N6O2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | [(2S,5R)-5-[2-amino-6-(cyclohexylamino)purin-9-yl]oxolan-2-yl]methanol |
| SMILES | Nc1nc(NC2CCCCC2)c2ncn([C@H]3CC[C@@H](CO)O3)c2n1 |
| InChI | InChI=1S/C16H24N6O2/c17-16-20-14(19-10-4-2-1-3-5-10)13-15(21-16)22(9-18-13)12-7-6-11(8-23)24-12/h9-12,23H,1-8H2,(H3,17,19,20,21)/t11-,12+/m0/s1 |
| InChIKey | RLTYCZVLPOTJIE-NWDGAFQWSA-N |
| XLogP | 1.82 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |