C13H19N7O — CID 123996190
9-[5-(aminomethyl)oxolan-2-yl]-6-N-cyclopropylpurine-2,6-diamine (PubChem CID 123996190) has the molecular formula C13H19N7O and a molecular weight of 289.34 g/mol. Its IUPAC name is 9-[5-(aminomethyl)oxolan-2-yl]-6-N-cyclopropylpurine-2,6-diamine.
| Compound Name | 9-[5-(aminomethyl)oxolan-2-yl]-6-N-cyclopropylpurine-2,6-diamine |
|---|---|
| PubChem CID | 123996190 |
| Molecular Formula | C13H19N7O |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 9-[5-(aminomethyl)oxolan-2-yl]-6-N-cyclopropylpurine-2,6-diamine |
| SMILES | NCC1CCC(n2cnc3c(NC4CC4)nc(N)nc32)O1 |
| InChI | InChI=1S/C13H19N7O/c14-5-8-3-4-9(21-8)20-6-16-10-11(17-7-1-2-7)18-13(15)19-12(10)20/h6-9H,1-5,14H2,(H3,15,17,18,19) |
| InChIKey | OGKPAELESRVJGZ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 116.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |