C14H18N6O2 — CID 170455114
[(2R,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]-6-oxabicyclo[3.1.0]hexan-2-yl]methanol (PubChem CID 170455114) has the molecular formula C14H18N6O2 and a molecular weight of 302.34 g/mol. Its IUPAC name is [(2R,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]-6-oxabicyclo[3.1.0]hexan-2-yl]methanol.
| Compound Name | [(2R,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]-6-oxabicyclo[3.1.0]hexan-2-yl]methanol |
|---|---|
| PubChem CID | 170455114 |
| Molecular Formula | C14H18N6O2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | [(2R,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]-6-oxabicyclo[3.1.0]hexan-2-yl]methanol |
| SMILES | Nc1nc(NC2CC2)c2ncn([C@@H]3C[C@H](CO)C4OC43)c2n1 |
| InChI | InChI=1S/C14H18N6O2/c15-14-18-12(17-7-1-2-7)9-13(19-14)20(5-16-9)8-3-6(4-21)10-11(8)22-10/h5-8,10-11,21H,1-4H2,(H3,15,17,18,19)/t6-,8-,10?,11?/m1/s1 |
| InChIKey | LTTSWMPKFUGQEO-QKMLYWASSA-N |
| XLogP | 0.30 |
| TPSA | 114.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|