C14H20N6O — CID 156801983
[(3S)-3-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopentyl]methanol (PubChem CID 156801983) has the molecular formula C14H20N6O and a molecular weight of 288.35 g/mol. Its IUPAC name is [(3S)-3-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopentyl]methanol.
| Compound Name | [(3S)-3-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 156801983 |
| Molecular Formula | C14H20N6O |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | [(3S)-3-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopentyl]methanol |
| SMILES | Nc1nc(NC2CC2)c2ncn([C@H]3CCC(CO)C3)c2n1 |
| InChI | InChI=1S/C14H20N6O/c15-14-18-12(17-9-2-3-9)11-13(19-14)20(7-16-11)10-4-1-8(5-10)6-21/h7-10,21H,1-6H2,(H3,15,17,18,19)/t8?,10-/m0/s1 |
| InChIKey | TYPRESGPNUCUCA-HTLJXXAVSA-N |
| XLogP | 1.32 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |