C14H17IN6O — CID 154544478
[4-[2-amino-6-(cyclopropylamino)purin-9-yl]-1-iodocyclopent-2-en-1-yl]methanol (PubChem CID 154544478) has the molecular formula C14H17IN6O and a molecular weight of 412.24 g/mol. Its IUPAC name is [4-[2-amino-6-(cyclopropylamino)purin-9-yl]-1-iodocyclopent-2-en-1-yl]methanol.
| Compound Name | [4-[2-amino-6-(cyclopropylamino)purin-9-yl]-1-iodocyclopent-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 154544478 |
| Molecular Formula | C14H17IN6O |
| Molecular Weight | 412.24 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | [4-[2-amino-6-(cyclopropylamino)purin-9-yl]-1-iodocyclopent-2-en-1-yl]methanol |
| SMILES | Nc1nc(NC2CC2)c2ncn(C3C=CC(I)(CO)C3)c2n1 |
| InChI | InChI=1S/C14H17IN6O/c15-14(6-22)4-3-9(5-14)21-7-17-10-11(18-8-1-2-8)19-13(16)20-12(10)21/h3-4,7-9,22H,1-2,5-6H2,(H3,16,18,19,20) |
| InChIKey | RZDATWSUFKFXQU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|