C14H22Br2N6O2 — CID 67082550
[(1S,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methanol;hydrate;dihydrobromide (PubChem CID 67082550) has the molecular formula C14H22Br2N6O2 and a molecular weight of 466.18 g/mol. Its IUPAC name is [(1S,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methanol;hydrate;dihydrobromide.
| Compound Name | [(1S,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methanol;hydrate;dihydrobromide |
|---|---|
| PubChem CID | 67082550 |
| Molecular Formula | C14H22Br2N6O2 |
| Molecular Weight | 466.18 g/mol |
| Exact Mass | 464.02 |
| IUPAC Name | [(1S,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methanol;hydrate;dihydrobromide |
| SMILES | Br.Br.Nc1nc(NC2CC2)c2ncn([C@H]3C=C[C@@H](CO)C3)c2n1.O |
| InChI | InChI=1S/C14H18N6O.2BrH.H2O/c15-14-18-12(17-9-2-3-9)11-13(19-14)20(7-16-11)10-4-1-8(5-10)6-21;;;/h1,4,7-10,21H,2-3,5-6H2,(H3,15,17,18,19);2*1H;1H2/t8-,10+;;;/m1.../s1 |
| InChIKey | LJRXZPYEXRYAJS-UYTFZFADSA-N |
| XLogP | 1.42 |
| TPSA | 133.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.18 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|