C13H18N6O — CID 18646989
[(1R,4S)-4-[2-amino-6-(dimethylamino)purin-9-yl]cyclopent-2-en-1-yl]methanol (PubChem CID 18646989) has the molecular formula C13H18N6O and a molecular weight of 274.33 g/mol. Its IUPAC name is [(1R,4S)-4-[2-amino-6-(dimethylamino)purin-9-yl]cyclopent-2-en-1-yl]methanol.
| Compound Name | [(1R,4S)-4-[2-amino-6-(dimethylamino)purin-9-yl]cyclopent-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 18646989 |
| Molecular Formula | C13H18N6O |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | [(1R,4S)-4-[2-amino-6-(dimethylamino)purin-9-yl]cyclopent-2-en-1-yl]methanol |
| SMILES | CN(C)c1nc(N)nc2c1ncn2[C@@H]1C=C[C@H](CO)C1 |
| InChI | InChI=1S/C13H18N6O/c1-18(2)11-10-12(17-13(14)16-11)19(7-15-10)9-4-3-8(5-9)6-20/h3-4,7-9,20H,5-6H2,1-2H3,(H2,14,16,17)/t8-,9+/m0/s1 |
| InChIKey | ZRHWHCUSHGSMDV-DTWKUNHWSA-N |
| XLogP | 0.58 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|