C12H15N5OS — CID 67797601
[(1S,4R)-4-(2-amino-6-methylsulfanylpurin-9-yl)cyclopent-2-en-1-yl]methanol (PubChem CID 67797601) has the molecular formula C12H15N5OS and a molecular weight of 277.35 g/mol. Its IUPAC name is [(1S,4R)-4-(2-amino-6-methylsulfanylpurin-9-yl)cyclopent-2-en-1-yl]methanol.
| Compound Name | [(1S,4R)-4-(2-amino-6-methylsulfanylpurin-9-yl)cyclopent-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 67797601 |
| Molecular Formula | C12H15N5OS |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | [(1S,4R)-4-(2-amino-6-methylsulfanylpurin-9-yl)cyclopent-2-en-1-yl]methanol |
| SMILES | CSc1nc(N)nc2c1ncn2[C@H]1C=C[C@@H](CO)C1 |
| InChI | InChI=1S/C12H15N5OS/c1-19-11-9-10(15-12(13)16-11)17(6-14-9)8-3-2-7(4-8)5-18/h2-3,6-8,18H,4-5H2,1H3,(H2,13,15,16)/t7-,8+/m1/s1 |
| InChIKey | PQNJVTOQOVXZMZ-SFYZADRCSA-N |
| XLogP | 1.24 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|