C16H22N6O — CID 57063501
[(1R,4S)-4-[2-amino-6-[cyclopropyl(ethyl)amino]purin-9-yl]cyclopent-2-en-1-yl]methanol (PubChem CID 57063501) has the molecular formula C16H22N6O and a molecular weight of 314.39 g/mol. Its IUPAC name is [(1R,4S)-4-[2-amino-6-[cyclopropyl(ethyl)amino]purin-9-yl]cyclopent-2-en-1-yl]methanol.
| Compound Name | [(1R,4S)-4-[2-amino-6-[cyclopropyl(ethyl)amino]purin-9-yl]cyclopent-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 57063501 |
| Molecular Formula | C16H22N6O |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | [(1R,4S)-4-[2-amino-6-[cyclopropyl(ethyl)amino]purin-9-yl]cyclopent-2-en-1-yl]methanol |
| SMILES | CCN(c1nc(N)nc2c1ncn2[C@@H]1C=C[C@H](CO)C1)C1CC1 |
| InChI | InChI=1S/C16H22N6O/c1-2-21(11-5-6-11)14-13-15(20-16(17)19-14)22(9-18-13)12-4-3-10(7-12)8-23/h3-4,9-12,23H,2,5-8H2,1H3,(H2,17,19,20)/t10-,12+/m0/s1 |
| InChIKey | JTYZNTWFNOXPQW-CMPLNLGQSA-N |
| XLogP | 1.51 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|