C17H26N6O — CID 156801971
[4-(2-amino-6-pyrrolidin-1-ylpurin-9-yl)cyclopent-2-en-1-yl]methanol;ethane (PubChem CID 156801971) has the molecular formula C17H26N6O and a molecular weight of 330.44 g/mol. Its IUPAC name is [4-(2-amino-6-pyrrolidin-1-ylpurin-9-yl)cyclopent-2-en-1-yl]methanol;ethane.
| Compound Name | [4-(2-amino-6-pyrrolidin-1-ylpurin-9-yl)cyclopent-2-en-1-yl]methanol;ethane |
|---|---|
| PubChem CID | 156801971 |
| Molecular Formula | C17H26N6O |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | [4-(2-amino-6-pyrrolidin-1-ylpurin-9-yl)cyclopent-2-en-1-yl]methanol;ethane |
| SMILES | CC.Nc1nc(N2CCCC2)c2ncn(C3C=CC(CO)C3)c2n1 |
| InChI | InChI=1S/C15H20N6O.C2H6/c16-15-18-13(20-5-1-2-6-20)12-14(19-15)21(9-17-12)11-4-3-10(7-11)8-22;1-2/h3-4,9-11,22H,1-2,5-8H2,(H2,16,18,19);1-2H3 |
| InChIKey | LRHYSZFORHUYIQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|