C14H20N6O3 — CID 19822751
2-[[2-amino-9-[4-(hydroxymethyl)cyclopent-2-en-1-yl]purin-6-yl]amino]propane-1,3-diol (PubChem CID 19822751) has the molecular formula C14H20N6O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is 2-[[2-amino-9-[4-(hydroxymethyl)cyclopent-2-en-1-yl]purin-6-yl]amino]propane-1,3-diol.
| Compound Name | 2-[[2-amino-9-[4-(hydroxymethyl)cyclopent-2-en-1-yl]purin-6-yl]amino]propane-1,3-diol |
|---|---|
| PubChem CID | 19822751 |
| Molecular Formula | C14H20N6O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 2-[[2-amino-9-[4-(hydroxymethyl)cyclopent-2-en-1-yl]purin-6-yl]amino]propane-1,3-diol |
| SMILES | Nc1nc(NC(CO)CO)c2ncn(C3C=CC(CO)C3)c2n1 |
| InChI | InChI=1S/C14H20N6O3/c15-14-18-12(17-9(5-22)6-23)11-13(19-14)20(7-16-11)10-2-1-8(3-10)4-21/h1-2,7-10,21-23H,3-6H2,(H3,15,17,18,19) |
| InChIKey | MMBWGYDQCQCJIQ-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 142.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|