C12H18N6O4 — CID 10924939
(1R,2S,3R,5R)-3-[2-amino-6-(methoxyamino)purin-9-yl]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 10924939) has the molecular formula C12H18N6O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[2-amino-6-(methoxyamino)purin-9-yl]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[2-amino-6-(methoxyamino)purin-9-yl]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 10924939 |
| Molecular Formula | C12H18N6O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (1R,2S,3R,5R)-3-[2-amino-6-(methoxyamino)purin-9-yl]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | CONc1nc(N)nc2c1ncn2[C@@H]1C[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H18N6O4/c1-22-17-10-7-11(16-12(13)15-10)18(4-14-7)6-2-5(3-19)8(20)9(6)21/h4-6,8-9,19-21H,2-3H2,1H3,(H3,13,15,16,17)/t5-,6-,8-,9+/m1/s1 |
| InChIKey | ZZMKNGRNBPZTFE-GCXDCGAKSA-N |
| XLogP | -1.34 |
| TPSA | 151.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|