C12H18N6O5 — CID 53231132
(2R,3S,4R,5R)-5-[2-amino-6-(methoxyamino)purin-9-yl]-2-(hydroxymethyl)-3-methyloxolane-3,4-diol (PubChem CID 53231132) has the molecular formula C12H18N6O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is (2R,3S,4R,5R)-5-[2-amino-6-(methoxyamino)purin-9-yl]-2-(hydroxymethyl)-3-methyloxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-5-[2-amino-6-(methoxyamino)purin-9-yl]-2-(hydroxymethyl)-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 53231132 |
| Molecular Formula | C12H18N6O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | (2R,3S,4R,5R)-5-[2-amino-6-(methoxyamino)purin-9-yl]-2-(hydroxymethyl)-3-methyloxolane-3,4-diol |
| SMILES | CONc1nc(N)nc2c1ncn2[C@@H]1O[C@H](CO)[C@@](C)(O)[C@H]1O |
| InChI | InChI=1S/C12H18N6O5/c1-12(21)5(3-19)23-10(7(12)20)18-4-14-6-8(17-22-2)15-11(13)16-9(6)18/h4-5,7,10,19-21H,3H2,1-2H3,(H3,13,15,16,17)/t5-,7+,10-,12-/m1/s1 |
| InChIKey | FYCGNWNOCRJLDR-OEBFKYMWSA-N |
| XLogP | -1.62 |
| TPSA | 160.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|