C13H18ClN5O2 — CID 88503264
1-[2-(2-amino-6-chloropurin-9-yl)-4-(hydroxymethyl)cyclobutyl]propan-1-ol (PubChem CID 88503264) has the molecular formula C13H18ClN5O2 and a molecular weight of 311.77 g/mol. Its IUPAC name is 1-[2-(2-amino-6-chloropurin-9-yl)-4-(hydroxymethyl)cyclobutyl]propan-1-ol.
| Compound Name | 1-[2-(2-amino-6-chloropurin-9-yl)-4-(hydroxymethyl)cyclobutyl]propan-1-ol |
|---|---|
| PubChem CID | 88503264 |
| Molecular Formula | C13H18ClN5O2 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 1-[2-(2-amino-6-chloropurin-9-yl)-4-(hydroxymethyl)cyclobutyl]propan-1-ol |
| SMILES | CCC(O)C1C(CO)CC1n1cnc2c(Cl)nc(N)nc21 |
| InChI | InChI=1S/C13H18ClN5O2/c1-2-8(21)9-6(4-20)3-7(9)19-5-16-10-11(14)17-13(15)18-12(10)19/h5-9,20-21H,2-4H2,1H3,(H2,15,17,18) |
| InChIKey | HEDQRZJTRIBJBM-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |