C13H20N6O2 — CID 21145493
1-[3-(2,6-diaminopurin-9-yl)-2-(1-hydroxyethyl)cyclobutyl]ethanol (PubChem CID 21145493) has the molecular formula C13H20N6O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is 1-[3-(2,6-diaminopurin-9-yl)-2-(1-hydroxyethyl)cyclobutyl]ethanol.
| Compound Name | 1-[3-(2,6-diaminopurin-9-yl)-2-(1-hydroxyethyl)cyclobutyl]ethanol |
|---|---|
| PubChem CID | 21145493 |
| Molecular Formula | C13H20N6O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 1-[3-(2,6-diaminopurin-9-yl)-2-(1-hydroxyethyl)cyclobutyl]ethanol |
| SMILES | CC(O)C1CC(n2cnc3c(N)nc(N)nc32)C1C(C)O |
| InChI | InChI=1S/C13H20N6O2/c1-5(20)7-3-8(9(7)6(2)21)19-4-16-10-11(14)17-13(15)18-12(10)19/h4-9,20-21H,3H2,1-2H3,(H4,14,15,17,18) |
| InChIKey | CJRMOSCNFXFQAW-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 136.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |