C8H13N7 — CID 146232455
9-[(1R)-1-(methylamino)ethyl]purine-2,6-diamine (PubChem CID 146232455) has the molecular formula C8H13N7 and a molecular weight of 207.24 g/mol. Its IUPAC name is 9-[(1R)-1-(methylamino)ethyl]purine-2,6-diamine.
| Compound Name | 9-[(1R)-1-(methylamino)ethyl]purine-2,6-diamine |
|---|---|
| PubChem CID | 146232455 |
| Molecular Formula | C8H13N7 |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | 9-[(1R)-1-(methylamino)ethyl]purine-2,6-diamine |
| SMILES | CN[C@@H](C)n1cnc2c(N)nc(N)nc21 |
| InChI | InChI=1S/C8H13N7/c1-4(11-2)15-3-12-5-6(9)13-8(10)14-7(5)15/h3-4,11H,1-2H3,(H4,9,10,13,14)/t4-/m1/s1 |
| InChIKey | GLXACSRCHAOUGH-SCSAIBSYSA-N |
| XLogP | -0.27 |
| TPSA | 107.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |