C9H13N6O4P — CID 70490569
(2,6-diaminopurin-9-yl)-(2-hydroxy-1,3,2-dioxaphosphinan-5-yl)methanol (PubChem CID 70490569) has the molecular formula C9H13N6O4P and a molecular weight of 300.22 g/mol. Its IUPAC name is (2,6-diaminopurin-9-yl)-(2-hydroxy-1,3,2-dioxaphosphinan-5-yl)methanol.
| Compound Name | (2,6-diaminopurin-9-yl)-(2-hydroxy-1,3,2-dioxaphosphinan-5-yl)methanol |
|---|---|
| PubChem CID | 70490569 |
| Molecular Formula | C9H13N6O4P |
| Molecular Weight | 300.22 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | (2,6-diaminopurin-9-yl)-(2-hydroxy-1,3,2-dioxaphosphinan-5-yl)methanol |
| SMILES | Nc1nc(N)c2ncn(C(O)C3COP(O)OC3)c2n1 |
| InChI | InChI=1S/C9H13N6O4P/c10-6-5-7(14-9(11)13-6)15(3-12-5)8(16)4-1-18-20(17)19-2-4/h3-4,8,16-17H,1-2H2,(H4,10,11,13,14) |
| InChIKey | CULYJTRCMFQCCC-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 154.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.22 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|