C9H11ClN5O4P — CID 19868867
6-chloro-9-[(2-hydroxy-1,3,2-dioxaphosphinan-5-yl)oxymethyl]purin-2-amine (PubChem CID 19868867) has the molecular formula C9H11ClN5O4P and a molecular weight of 319.65 g/mol. Its IUPAC name is 6-chloro-9-[(2-hydroxy-1,3,2-dioxaphosphinan-5-yl)oxymethyl]purin-2-amine.
| Compound Name | 6-chloro-9-[(2-hydroxy-1,3,2-dioxaphosphinan-5-yl)oxymethyl]purin-2-amine |
|---|---|
| PubChem CID | 19868867 |
| Molecular Formula | C9H11ClN5O4P |
| Molecular Weight | 319.65 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 6-chloro-9-[(2-hydroxy-1,3,2-dioxaphosphinan-5-yl)oxymethyl]purin-2-amine |
| SMILES | Nc1nc(Cl)c2ncn(COC3COP(O)OC3)c2n1 |
| InChI | InChI=1S/C9H11ClN5O4P/c10-7-6-8(14-9(11)13-7)15(3-12-6)4-17-5-1-18-20(16)19-2-5/h3,5,16H,1-2,4H2,(H2,11,13,14) |
| InChIKey | UWVFKVURACMNKL-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.65 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|