C11H12ClF2N5 — CID 174675846
6-chloro-9-[(3-ethyl-2,2-difluorocyclopropyl)methyl]purin-2-amine (PubChem CID 174675846) has the molecular formula C11H12ClF2N5 and a molecular weight of 287.70 g/mol. Its IUPAC name is 6-chloro-9-[(3-ethyl-2,2-difluorocyclopropyl)methyl]purin-2-amine.
| Compound Name | 6-chloro-9-[(3-ethyl-2,2-difluorocyclopropyl)methyl]purin-2-amine |
|---|---|
| PubChem CID | 174675846 |
| Molecular Formula | C11H12ClF2N5 |
| Molecular Weight | 287.70 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 6-chloro-9-[(3-ethyl-2,2-difluorocyclopropyl)methyl]purin-2-amine |
| SMILES | CCC1C(Cn2cnc3c(Cl)nc(N)nc32)C1(F)F |
| InChI | InChI=1S/C11H12ClF2N5/c1-2-5-6(11(5,13)14)3-19-4-16-7-8(12)17-10(15)18-9(7)19/h4-6H,2-3H2,1H3,(H2,15,17,18) |
| InChIKey | AHUXLECVLVUUQE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.70 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |