C12H16ClN5O2 — CID 11781483
6-chloro-9-[2-(2-methyl-1,3-dioxan-5-yl)ethyl]purin-2-amine (PubChem CID 11781483) has the molecular formula C12H16ClN5O2 and a molecular weight of 297.75 g/mol. Its IUPAC name is 6-chloro-9-[2-(2-methyl-1,3-dioxan-5-yl)ethyl]purin-2-amine.
| Compound Name | 6-chloro-9-[2-(2-methyl-1,3-dioxan-5-yl)ethyl]purin-2-amine |
|---|---|
| PubChem CID | 11781483 |
| Molecular Formula | C12H16ClN5O2 |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 6-chloro-9-[2-(2-methyl-1,3-dioxan-5-yl)ethyl]purin-2-amine |
| SMILES | CC1OCC(CCn2cnc3c(Cl)nc(N)nc32)CO1 |
| InChI | InChI=1S/C12H16ClN5O2/c1-7-19-4-8(5-20-7)2-3-18-6-15-9-10(13)16-12(14)17-11(9)18/h6-8H,2-5H2,1H3,(H2,14,16,17) |
| InChIKey | YRALEEVRXSRCMA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |