C11H12ClN5O3 — CID 10827890
5-[2-(2-amino-6-chloropurin-9-yl)ethyl]-1,3-dioxan-2-one (PubChem CID 10827890) has the molecular formula C11H12ClN5O3 and a molecular weight of 297.70 g/mol. Its IUPAC name is 5-[2-(2-amino-6-chloropurin-9-yl)ethyl]-1,3-dioxan-2-one.
| Compound Name | 5-[2-(2-amino-6-chloropurin-9-yl)ethyl]-1,3-dioxan-2-one |
|---|---|
| PubChem CID | 10827890 |
| Molecular Formula | C11H12ClN5O3 |
| Molecular Weight | 297.70 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 5-[2-(2-amino-6-chloropurin-9-yl)ethyl]-1,3-dioxan-2-one |
| SMILES | Nc1nc(Cl)c2ncn(CCC3COC(=O)OC3)c2n1 |
| InChI | InChI=1S/C11H12ClN5O3/c12-8-7-9(16-10(13)15-8)17(5-14-7)2-1-6-3-19-11(18)20-4-6/h5-6H,1-4H2,(H2,13,15,16) |
| InChIKey | RUSCBNHEAJFNBV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.70 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |