C7H6ClN5 — CID 15374495
6-chloro-9-ethenylpurin-2-amine (PubChem CID 15374495) has the molecular formula C7H6ClN5 and a molecular weight of 195.61 g/mol. Its IUPAC name is 6-chloro-9-ethenylpurin-2-amine.
| Compound Name | 6-chloro-9-ethenylpurin-2-amine |
|---|---|
| PubChem CID | 15374495 |
| Molecular Formula | C7H6ClN5 |
| Molecular Weight | 195.61 g/mol |
| Exact Mass | 195.03 |
| IUPAC Name | 6-chloro-9-ethenylpurin-2-amine |
| SMILES | C=Cn1cnc2c(Cl)nc(N)nc21 |
| InChI | InChI=1S/C7H6ClN5/c1-2-13-3-10-4-5(8)11-7(9)12-6(4)13/h2-3H,1H2,(H2,9,11,12) |
| InChIKey | UAIYOQSTJKYFFL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.61 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |