C12H10ClN5O — CID 102575305
[(2Z)-2-[(2-amino-6-chloropurin-9-yl)methylidene]-1-ethynylcyclopropyl]methanol (PubChem CID 102575305) has the molecular formula C12H10ClN5O and a molecular weight of 275.70 g/mol. Its IUPAC name is [(2Z)-2-[(2-amino-6-chloropurin-9-yl)methylidene]-1-ethynylcyclopropyl]methanol.
| Compound Name | [(2Z)-2-[(2-amino-6-chloropurin-9-yl)methylidene]-1-ethynylcyclopropyl]methanol |
|---|---|
| PubChem CID | 102575305 |
| Molecular Formula | C12H10ClN5O |
| Molecular Weight | 275.70 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | [(2Z)-2-[(2-amino-6-chloropurin-9-yl)methylidene]-1-ethynylcyclopropyl]methanol |
| SMILES | C#CC1(CO)C/C1=C/n1cnc2c(Cl)nc(N)nc21 |
| InChI | InChI=1S/C12H10ClN5O/c1-2-12(5-19)3-7(12)4-18-6-15-8-9(13)16-11(14)17-10(8)18/h1,4,6,19H,3,5H2,(H2,14,16,17)/b7-4- |
| InChIKey | WHYVMIDTORMLGA-DAXSKMNVSA-N |
| XLogP | 0.92 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.70 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|