C8H8ClN5 — CID 71615634
6-chloro-9-[(E)-prop-1-enyl]purin-2-amine (PubChem CID 71615634) has the molecular formula C8H8ClN5 and a molecular weight of 209.64 g/mol. Its IUPAC name is 6-chloro-9-[(E)-prop-1-enyl]purin-2-amine.
| Compound Name | 6-chloro-9-[(E)-prop-1-enyl]purin-2-amine |
|---|---|
| PubChem CID | 71615634 |
| Molecular Formula | C8H8ClN5 |
| Molecular Weight | 209.64 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 6-chloro-9-[(E)-prop-1-enyl]purin-2-amine |
| SMILES | C/C=C/n1cnc2c(Cl)nc(N)nc21 |
| InChI | InChI=1S/C8H8ClN5/c1-2-3-14-4-11-5-6(9)12-8(10)13-7(5)14/h2-4H,1H3,(H2,10,12,13)/b3-2+ |
| InChIKey | XFCNDOZDVZXXHK-NSCUHMNNSA-N |
| XLogP | 1.55 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.64 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |