C12H14ClN5O3 — CID 166877500
(2R,3S,4R,5R)-5-(2-amino-6-chloropurin-9-yl)-4-ethenyl-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 166877500) has the molecular formula C12H14ClN5O3 and a molecular weight of 311.73 g/mol. Its IUPAC name is (2R,3S,4R,5R)-5-(2-amino-6-chloropurin-9-yl)-4-ethenyl-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,4R,5R)-5-(2-amino-6-chloropurin-9-yl)-4-ethenyl-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 166877500 |
| Molecular Formula | C12H14ClN5O3 |
| Molecular Weight | 311.73 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | (2R,3S,4R,5R)-5-(2-amino-6-chloropurin-9-yl)-4-ethenyl-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | C=C[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1n1cnc2c(Cl)nc(N)nc21 |
| InChI | InChI=1S/C12H14ClN5O3/c1-2-5-8(20)6(3-19)21-11(5)18-4-15-7-9(13)16-12(14)17-10(7)18/h2,4-6,8,11,19-20H,1,3H2,(H2,14,16,17)/t5-,6-,8+,11-/m1/s1 |
| InChIKey | KODBTQJXMZRNPO-JJCHFMHPSA-N |
| XLogP | 0.11 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.73 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|