C9H13ClN5O4P — CID 167008984
2-(2-amino-6-chloropurin-9-yl)ethoxymethyl-methoxyphosphinic acid (PubChem CID 167008984) has the molecular formula C9H13ClN5O4P and a molecular weight of 321.66 g/mol. Its IUPAC name is 2-(2-amino-6-chloropurin-9-yl)ethoxymethyl-methoxyphosphinic acid.
| Compound Name | 2-(2-amino-6-chloropurin-9-yl)ethoxymethyl-methoxyphosphinic acid |
|---|---|
| PubChem CID | 167008984 |
| Molecular Formula | C9H13ClN5O4P |
| Molecular Weight | 321.66 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 2-(2-amino-6-chloropurin-9-yl)ethoxymethyl-methoxyphosphinic acid |
| SMILES | COP(=O)(O)COCCn1cnc2c(Cl)nc(N)nc21 |
| InChI | InChI=1S/C9H13ClN5O4P/c1-18-20(16,17)5-19-3-2-15-4-12-6-7(10)13-9(11)14-8(6)15/h4H,2-3,5H2,1H3,(H,16,17)(H2,11,13,14) |
| InChIKey | MJHLKSJNVIXTGK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.66 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|