C14H18N5O8P — CID 118968337
2-(2-amino-6-methoxypurin-9-yl)ethoxymethyl-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]phosphinic acid (PubChem CID 118968337) has the molecular formula C14H18N5O8P and a molecular weight of 415.30 g/mol. Its IUPAC name is 2-(2-amino-6-methoxypurin-9-yl)ethoxymethyl-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]phosphinic acid.
| Compound Name | 2-(2-amino-6-methoxypurin-9-yl)ethoxymethyl-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]phosphinic acid |
|---|---|
| PubChem CID | 118968337 |
| Molecular Formula | C14H18N5O8P |
| Molecular Weight | 415.30 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 2-(2-amino-6-methoxypurin-9-yl)ethoxymethyl-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]phosphinic acid |
| SMILES | COc1nc(N)nc2c1ncn2CCOCP(=O)(O)OCc1oc(=O)oc1C |
| InChI | InChI=1S/C14H18N5O8P/c1-8-9(27-14(20)26-8)5-25-28(21,22)7-24-4-3-19-6-16-10-11(19)17-13(15)18-12(10)23-2/h6H,3-5,7H2,1-2H3,(H,21,22)(H2,15,17,18) |
| InChIKey | KZETUZHQWPFJFH-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 177.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.30 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|