C16H19FN5O6P — CID 137014446
2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(3-fluoro-4-methoxyphenyl)methoxy]phosphinic acid (PubChem CID 137014446) has the molecular formula C16H19FN5O6P and a molecular weight of 427.33 g/mol. Its IUPAC name is 2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(3-fluoro-4-methoxyphenyl)methoxy]phosphinic acid.
| Compound Name | 2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(3-fluoro-4-methoxyphenyl)methoxy]phosphinic acid |
|---|---|
| PubChem CID | 137014446 |
| Molecular Formula | C16H19FN5O6P |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(3-fluoro-4-methoxyphenyl)methoxy]phosphinic acid |
| SMILES | COc1ccc(COP(=O)(O)COCCn2cnc3c(=O)[nH]c(N)nc32)cc1F |
| InChI | InChI=1S/C16H19FN5O6P/c1-26-12-3-2-10(6-11(12)17)7-28-29(24,25)9-27-5-4-22-8-19-13-14(22)20-16(18)21-15(13)23/h2-3,6,8H,4-5,7,9H2,1H3,(H,24,25)(H3,18,20,21,23) |
| InChIKey | YERGZBWMFLVWBJ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 154.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|