C21H27FN5O7P — CID 136953877
2-amino-9-[2-[2-[(3-fluoro-4-methoxyphenyl)methoxy-(2-oxobutoxy)phosphoryl]ethoxy]ethyl]-1H-purin-6-one (PubChem CID 136953877) has the molecular formula C21H27FN5O7P and a molecular weight of 511.45 g/mol. Its IUPAC name is 2-amino-9-[2-[2-[(3-fluoro-4-methoxyphenyl)methoxy-(2-oxobutoxy)phosphoryl]ethoxy]ethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-[2-[(3-fluoro-4-methoxyphenyl)methoxy-(2-oxobutoxy)phosphoryl]ethoxy]ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136953877 |
| Molecular Formula | C21H27FN5O7P |
| Molecular Weight | 511.45 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | 2-amino-9-[2-[2-[(3-fluoro-4-methoxyphenyl)methoxy-(2-oxobutoxy)phosphoryl]ethoxy]ethyl]-1H-purin-6-one |
| SMILES | CCC(=O)COP(=O)(CCOCCn1cnc2c(=O)[nH]c(N)nc21)OCc1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C21H27FN5O7P/c1-3-15(28)12-34-35(30,33-11-14-4-5-17(31-2)16(22)10-14)9-8-32-7-6-27-13-24-18-19(27)25-21(23)26-20(18)29/h4-5,10,13H,3,6-9,11-12H2,1-2H3,(H3,23,25,26,29) |
| InChIKey | RPESSQYUVIKWSE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 160.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|