C21H28FN6O7P — CID 137014012
ethyl (2S)-2-[[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(3-fluoro-4-methoxyphenyl)methoxy]phosphoryl]amino]propanoate (PubChem CID 137014012) has the molecular formula C21H28FN6O7P and a molecular weight of 526.46 g/mol. Its IUPAC name is ethyl (2S)-2-[[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(3-fluoro-4-methoxyphenyl)methoxy]phosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(3-fluoro-4-methoxyphenyl)methoxy]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 137014012 |
| Molecular Formula | C21H28FN6O7P |
| Molecular Weight | 526.46 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | ethyl (2S)-2-[[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(3-fluoro-4-methoxyphenyl)methoxy]phosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(COCCn1cnc2c(=O)[nH]c(N)nc21)OCc1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C21H28FN6O7P/c1-4-34-20(30)13(2)27-36(31,35-10-14-5-6-16(32-3)15(22)9-14)12-33-8-7-28-11-24-17-18(28)25-21(23)26-19(17)29/h5-6,9,11,13H,4,7-8,10,12H2,1-3H3,(H,27,31)(H3,23,25,26,29)/t13-,36?/m0/s1 |
| InChIKey | KODSKBWRXLHDJB-JWFSFFBCSA-N |
| XLogP | 1.77 |
| TPSA | 172.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.46 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|