C25H35FN5O7PS — CID 136953907
S-[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(3-fluoro-4-methoxyphenyl)methoxy]phosphoryl]oxyethyl] 4,4-dimethylpentanethioate (PubChem CID 136953907) has the molecular formula C25H35FN5O7PS and a molecular weight of 599.62 g/mol. Its IUPAC name is S-[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(3-fluoro-4-methoxyphenyl)methoxy]phosphoryl]oxyethyl] 4,4-dimethylpentanethioate.
| Compound Name | S-[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(3-fluoro-4-methoxyphenyl)methoxy]phosphoryl]oxyethyl] 4,4-dimethylpentanethioate |
|---|---|
| PubChem CID | 136953907 |
| Molecular Formula | C25H35FN5O7PS |
| Molecular Weight | 599.62 g/mol |
| Exact Mass | 599.20 |
| IUPAC Name | S-[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(3-fluoro-4-methoxyphenyl)methoxy]phosphoryl]oxyethyl] 4,4-dimethylpentanethioate |
| SMILES | COc1ccc(COP(=O)(COCCn2cnc3c(=O)[nH]c(N)nc32)OCCSC(=O)CCC(C)(C)C)cc1F |
| InChI | InChI=1S/C25H35FN5O7PS/c1-25(2,3)8-7-20(32)40-12-11-37-39(34,38-14-17-5-6-19(35-4)18(26)13-17)16-36-10-9-31-15-28-21-22(31)29-24(27)30-23(21)33/h5-6,13,15H,7-12,14,16H2,1-4H3,(H3,27,29,30,33) |
| InChIKey | OFTFEGVPAHCBMI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 160.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.62 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|