C24H25FN5O6PS — CID 137014130
S-[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-phenylmethoxyphosphoryl]oxyethyl] 4-fluorobenzenecarbothioate (PubChem CID 137014130) has the molecular formula C24H25FN5O6PS and a molecular weight of 561.53 g/mol. Its IUPAC name is S-[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-phenylmethoxyphosphoryl]oxyethyl] 4-fluorobenzenecarbothioate.
| Compound Name | S-[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-phenylmethoxyphosphoryl]oxyethyl] 4-fluorobenzenecarbothioate |
|---|---|
| PubChem CID | 137014130 |
| Molecular Formula | C24H25FN5O6PS |
| Molecular Weight | 561.53 g/mol |
| Exact Mass | 561.12 |
| IUPAC Name | S-[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-phenylmethoxyphosphoryl]oxyethyl] 4-fluorobenzenecarbothioate |
| SMILES | Nc1nc2c(ncn2CCOCP(=O)(OCCSC(=O)c2ccc(F)cc2)OCc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C24H25FN5O6PS/c25-19-8-6-18(7-9-19)23(32)38-13-12-35-37(33,36-14-17-4-2-1-3-5-17)16-34-11-10-30-15-27-20-21(30)28-24(26)29-22(20)31/h1-9,15H,10-14,16H2,(H3,26,28,29,31) |
| InChIKey | NVEWWDOQFUIMCY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|