C21H25BrN5O6PS — CID 136953744
S-[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(3-bromophenyl)methoxy]phosphoryl]oxyethyl] but-3-enethioate (PubChem CID 136953744) has the molecular formula C21H25BrN5O6PS and a molecular weight of 586.41 g/mol. Its IUPAC name is S-[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(3-bromophenyl)methoxy]phosphoryl]oxyethyl] but-3-enethioate.
| Compound Name | S-[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(3-bromophenyl)methoxy]phosphoryl]oxyethyl] but-3-enethioate |
|---|---|
| PubChem CID | 136953744 |
| Molecular Formula | C21H25BrN5O6PS |
| Molecular Weight | 586.41 g/mol |
| Exact Mass | 585.04 |
| IUPAC Name | S-[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(3-bromophenyl)methoxy]phosphoryl]oxyethyl] but-3-enethioate |
| SMILES | C=CCC(=O)SCCOP(=O)(COCCn1cnc2c(=O)[nH]c(N)nc21)OCc1cccc(Br)c1 |
| InChI | InChI=1S/C21H25BrN5O6PS/c1-2-4-17(28)35-10-9-32-34(30,33-12-15-5-3-6-16(22)11-15)14-31-8-7-27-13-24-18-19(27)25-21(23)26-20(18)29/h2-3,5-6,11,13H,1,4,7-10,12,14H2,(H3,23,25,26,29) |
| InChIKey | JECVBFHGKIHDJK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|