C23H33BrN5O6P — CID 163798476
2-amino-9-[2-[[(3-bromophenyl)methoxy-(2-butoxybutoxy)phosphoryl]methoxy]ethyl]-1H-purin-6-one (PubChem CID 163798476) has the molecular formula C23H33BrN5O6P and a molecular weight of 586.42 g/mol. Its IUPAC name is 2-amino-9-[2-[[(3-bromophenyl)methoxy-(2-butoxybutoxy)phosphoryl]methoxy]ethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-[[(3-bromophenyl)methoxy-(2-butoxybutoxy)phosphoryl]methoxy]ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 163798476 |
| Molecular Formula | C23H33BrN5O6P |
| Molecular Weight | 586.42 g/mol |
| Exact Mass | 585.14 |
| IUPAC Name | 2-amino-9-[2-[[(3-bromophenyl)methoxy-(2-butoxybutoxy)phosphoryl]methoxy]ethyl]-1H-purin-6-one |
| SMILES | CCCCOC(CC)COP(=O)(COCCn1cnc2c(=O)[nH]c(N)nc21)OCc1cccc(Br)c1 |
| InChI | InChI=1S/C23H33BrN5O6P/c1-3-5-10-33-19(4-2)14-35-36(31,34-13-17-7-6-8-18(24)12-17)16-32-11-9-29-15-26-20-21(29)27-23(25)28-22(20)30/h6-8,12,15,19H,3-5,9-11,13-14,16H2,1-2H3,(H3,25,27,28,30) |
| InChIKey | AJFLDNKSHBWPAR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 143.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|