C19H23IN5O6PS — CID 149375302
S-[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-phenylmethoxyphosphoryl]oxyethyl] 2-iodoethanethioate (PubChem CID 149375302) has the molecular formula C19H23IN5O6PS and a molecular weight of 607.37 g/mol. Its IUPAC name is S-[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-phenylmethoxyphosphoryl]oxyethyl] 2-iodoethanethioate.
| Compound Name | S-[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-phenylmethoxyphosphoryl]oxyethyl] 2-iodoethanethioate |
|---|---|
| PubChem CID | 149375302 |
| Molecular Formula | C19H23IN5O6PS |
| Molecular Weight | 607.37 g/mol |
| Exact Mass | 607.02 |
| IUPAC Name | S-[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-phenylmethoxyphosphoryl]oxyethyl] 2-iodoethanethioate |
| SMILES | Nc1nc2c(ncn2CCOCP(=O)(OCCSC(=O)CI)OCc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C19H23IN5O6PS/c20-10-15(26)33-9-8-30-32(28,31-11-14-4-2-1-3-5-14)13-29-7-6-25-12-22-16-17(25)23-19(21)24-18(16)27/h1-5,12H,6-11,13H2,(H3,21,23,24,27) |
| InChIKey | YKPOETIUZNWDQZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|