C25H28N5O7P — CID 136953560
2-amino-9-[2-[[[2-(3-methoxy-4-methylphenyl)-2-oxoethoxy]-phenylmethoxyphosphoryl]methoxy]ethyl]-1H-purin-6-one (PubChem CID 136953560) has the molecular formula C25H28N5O7P and a molecular weight of 541.50 g/mol. Its IUPAC name is 2-amino-9-[2-[[[2-(3-methoxy-4-methylphenyl)-2-oxoethoxy]-phenylmethoxyphosphoryl]methoxy]ethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-[[[2-(3-methoxy-4-methylphenyl)-2-oxoethoxy]-phenylmethoxyphosphoryl]methoxy]ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136953560 |
| Molecular Formula | C25H28N5O7P |
| Molecular Weight | 541.50 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | 2-amino-9-[2-[[[2-(3-methoxy-4-methylphenyl)-2-oxoethoxy]-phenylmethoxyphosphoryl]methoxy]ethyl]-1H-purin-6-one |
| SMILES | COc1cc(C(=O)COP(=O)(COCCn2cnc3c(=O)[nH]c(N)nc32)OCc2ccccc2)ccc1C |
| InChI | InChI=1S/C25H28N5O7P/c1-17-8-9-19(12-21(17)34-2)20(31)14-37-38(33,36-13-18-6-4-3-5-7-18)16-35-11-10-30-15-27-22-23(30)28-25(26)29-24(22)32/h3-9,12,15H,10-11,13-14,16H2,1-2H3,(H3,26,28,29,32) |
| InChIKey | UVETWBNFROQEGH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 160.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|