C24H25FN5O8P — CID 137014083
[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(4-methylphenyl)methoxy]phosphoryl]oxymethyl (4-fluorophenyl) carbonate (PubChem CID 137014083) has the molecular formula C24H25FN5O8P and a molecular weight of 561.46 g/mol. Its IUPAC name is [2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(4-methylphenyl)methoxy]phosphoryl]oxymethyl (4-fluorophenyl) carbonate.
| Compound Name | [2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(4-methylphenyl)methoxy]phosphoryl]oxymethyl (4-fluorophenyl) carbonate |
|---|---|
| PubChem CID | 137014083 |
| Molecular Formula | C24H25FN5O8P |
| Molecular Weight | 561.46 g/mol |
| Exact Mass | 561.14 |
| IUPAC Name | [2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(4-methylphenyl)methoxy]phosphoryl]oxymethyl (4-fluorophenyl) carbonate |
| SMILES | Cc1ccc(COP(=O)(COCCn2cnc3c(=O)[nH]c(N)nc32)OCOC(=O)Oc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C24H25FN5O8P/c1-16-2-4-17(5-3-16)12-36-39(33,37-14-35-24(32)38-19-8-6-18(25)7-9-19)15-34-11-10-30-13-27-20-21(30)28-23(26)29-22(20)31/h2-9,13H,10-12,14-15H2,1H3,(H3,26,28,29,31) |
| InChIKey | TZSKHGIYTKGKBU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 169.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|