C23H32N7O7P — CID 137033651
ethyl (2R)-2-[[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[[(2R)-1-oxo-1-phenylmethoxypropan-2-yl]amino]phosphoryl]amino]propanoate (PubChem CID 137033651) has the molecular formula C23H32N7O7P and a molecular weight of 549.53 g/mol. Its IUPAC name is ethyl (2R)-2-[[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[[(2R)-1-oxo-1-phenylmethoxypropan-2-yl]amino]phosphoryl]amino]propanoate.
| Compound Name | ethyl (2R)-2-[[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[[(2R)-1-oxo-1-phenylmethoxypropan-2-yl]amino]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 137033651 |
| Molecular Formula | C23H32N7O7P |
| Molecular Weight | 549.53 g/mol |
| Exact Mass | 549.21 |
| IUPAC Name | ethyl (2R)-2-[[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[[(2R)-1-oxo-1-phenylmethoxypropan-2-yl]amino]phosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@@H](C)NP(=O)(COCCn1cnc2c(=O)[nH]c(N)nc21)N[C@H](C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H32N7O7P/c1-4-36-21(32)15(2)28-38(34,29-16(3)22(33)37-12-17-8-6-5-7-9-17)14-35-11-10-30-13-25-18-19(30)26-23(24)27-20(18)31/h5-9,13,15-16H,4,10-12,14H2,1-3H3,(H2,28,29,34)(H3,24,26,27,31)/t15-,16-,38?/m1/s1 |
| InChIKey | HVAXCKKBCRXMOV-BLLRFYCTSA-N |
| XLogP | 1.13 |
| TPSA | 192.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.53 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|