C21H29N6O7PS — CID 145046102
ethyl 2-[[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(4-methylsulfonylphenyl)methoxy]phosphanyl]amino]propanoate (PubChem CID 145046102) has the molecular formula C21H29N6O7PS and a molecular weight of 540.54 g/mol. Its IUPAC name is ethyl 2-[[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(4-methylsulfonylphenyl)methoxy]phosphanyl]amino]propanoate.
| Compound Name | ethyl 2-[[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(4-methylsulfonylphenyl)methoxy]phosphanyl]amino]propanoate |
|---|---|
| PubChem CID | 145046102 |
| Molecular Formula | C21H29N6O7PS |
| Molecular Weight | 540.54 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | ethyl 2-[[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(4-methylsulfonylphenyl)methoxy]phosphanyl]amino]propanoate |
| SMILES | CCOC(=O)C(C)NP(COCCn1cnc2c(=O)[nH]c(N)nc21)OCc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H29N6O7PS/c1-4-33-20(29)14(2)26-35(34-11-15-5-7-16(8-6-15)36(3,30)31)13-32-10-9-27-12-23-17-18(27)24-21(22)25-19(17)28/h5-8,12,14,26H,4,9-11,13H2,1-3H3,(H3,22,24,25,28) |
| InChIKey | MHZJJHLXZZKRSJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 180.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.54 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|