C20H24N7O5P — CID 145045885
ethyl 2-[[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(4-cyanophenyl)methoxy]phosphanyl]amino]acetate (PubChem CID 145045885) has the molecular formula C20H24N7O5P and a molecular weight of 473.43 g/mol. Its IUPAC name is ethyl 2-[[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(4-cyanophenyl)methoxy]phosphanyl]amino]acetate.
| Compound Name | ethyl 2-[[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(4-cyanophenyl)methoxy]phosphanyl]amino]acetate |
|---|---|
| PubChem CID | 145045885 |
| Molecular Formula | C20H24N7O5P |
| Molecular Weight | 473.43 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | ethyl 2-[[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(4-cyanophenyl)methoxy]phosphanyl]amino]acetate |
| SMILES | CCOC(=O)CNP(COCCn1cnc2c(=O)[nH]c(N)nc21)OCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C20H24N7O5P/c1-2-31-16(28)10-24-33(32-11-15-5-3-14(9-21)4-6-15)13-30-8-7-27-12-23-17-18(27)25-20(22)26-19(17)29/h3-6,12,24H,2,7-8,10-11,13H2,1H3,(H3,22,25,26,29) |
| InChIKey | MBKPVHDBQZAJET-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 170.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.43 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|