C19H26N5O4PS — CID 145046036
2-amino-9-[2-[[(4-methylphenyl)methoxy-(2-methylsulfanylethoxy)phosphanyl]methoxy]ethyl]-1H-purin-6-one (PubChem CID 145046036) has the molecular formula C19H26N5O4PS and a molecular weight of 451.49 g/mol. Its IUPAC name is 2-amino-9-[2-[[(4-methylphenyl)methoxy-(2-methylsulfanylethoxy)phosphanyl]methoxy]ethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-[[(4-methylphenyl)methoxy-(2-methylsulfanylethoxy)phosphanyl]methoxy]ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 145046036 |
| Molecular Formula | C19H26N5O4PS |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 2-amino-9-[2-[[(4-methylphenyl)methoxy-(2-methylsulfanylethoxy)phosphanyl]methoxy]ethyl]-1H-purin-6-one |
| SMILES | CSCCOP(COCCn1cnc2c(=O)[nH]c(N)nc21)OCc1ccc(C)cc1 |
| InChI | InChI=1S/C19H26N5O4PS/c1-14-3-5-15(6-4-14)11-28-29(27-9-10-30-2)13-26-8-7-24-12-21-16-17(24)22-19(20)23-18(16)25/h3-6,12H,7-11,13H2,1-2H3,(H3,20,22,23,25) |
| InChIKey | LKFAARYJRXCHQI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|